ID | 150 |
---|---|
Name | dinocton |
CAS | 104078-12-8 |
IUPAC | reaction mixture of isomeric dinitro(octyl)phenyl methyl carbonates in which “octyl” is a mixture of 1-methylheptyl, 1-ethylhexyl and 1-propylpentyl groups |
Inchi | |
CIPAC | |
EPA Code | |
Formula | C16H22N2O7 |
SMILES | O(C(=O)OC([H])([H])[H])c1c(c([H])c(c([H])c1C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])[H])[N+](=O)[O-])[N+](=O)[O-] |
Status | Not Available |
Mode of Action | |
---|---|
Pesticide Type | |
Chemical Group | |
Classification |
dinitrophenol fungicides dinitrophenol acaricides |
Molecular Weight | 354.35508 |
---|---|
Physical State | |
AlogP | 5.504 |
H-Bond Donor | 0 |
H-Bond Acceptor | 7 |
Surface Area | 364.25 |
Polar Surface Area | 127.17 |
Network initializing...Please wait
Node List
ID | Name | Type |
---|---|---|
Legend: